C21H23N7 — CID 150226088
10-[4-(1-ethylpiperidin-4-yl)phenyl]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine (PubChem CID 150226088) has the molecular formula C21H23N7 and a molecular weight of 373.46 g/mol. Its IUPAC name is 10-[4-(1-ethylpiperidin-4-yl)phenyl]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine.
| Compound Name | 10-[4-(1-ethylpiperidin-4-yl)phenyl]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine |
|---|---|
| PubChem CID | 150226088 |
| Molecular Formula | C21H23N7 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 10-[4-(1-ethylpiperidin-4-yl)phenyl]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine |
| SMILES | CCN1CCC(c2ccc(-c3nc(N)nc4c3ccc3nncn34)cc2)CC1 |
| InChI | InChI=1S/C21H23N7/c1-2-27-11-9-15(10-12-27)14-3-5-16(6-4-14)19-17-7-8-18-26-23-13-28(18)20(17)25-21(22)24-19/h3-8,13,15H,2,9-12H2,1H3,(H2,22,24,25) |
| InChIKey | FUMMAJQETSWZLV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |