About 1-cyanobut-3-yn-2-yl hydrogen sulfite
1-cyanobut-3-yn-2-yl hydrogen sulfite (PubChem CID 150249313) has the molecular formula C5H5NO3S
and a molecular weight of 159.17 g/mol. Its IUPAC name is 1-cyanobut-3-yn-2-yl hydrogen sulfite.
Molecular Properties
| Compound Name | 1-cyanobut-3-yn-2-yl hydrogen sulfite |
| PubChem CID | 150249313 |
| Molecular Formula | C5H5NO3S |
| Molecular Weight | 159.17 g/mol |
| Exact Mass | 159.00 |
| IUPAC Name | 1-cyanobut-3-yn-2-yl hydrogen sulfite |
| SMILES | C#CC(CC#N)OS(=O)O |
| InChI | InChI=1S/C5H5NO3S/c1-2-5(3-4-6)9-10(7)8/h1,5H,3H2,(H,7,8) |
| InChIKey | FZEUGMMMODETPL-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.17 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-cyanobut-3-yn-2-yl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyanobut-3-yn-2-yl hydrogen sulfite?
The IUPAC name of 1-cyanobut-3-yn-2-yl hydrogen sulfite (CID 150249313) is 1-cyanobut-3-yn-2-yl hydrogen sulfite.
What is the SMILES notation for 1-cyanobut-3-yn-2-yl hydrogen sulfite?
The canonical SMILES for 1-cyanobut-3-yn-2-yl hydrogen sulfite is C#CC(CC#N)OS(=O)O.
What is the InChIKey of 1-cyanobut-3-yn-2-yl hydrogen sulfite?
The InChIKey is FZEUGMMMODETPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO3S/c1-2-5(3-4-6)9-10(7)8/h1,5H,3H2,(H,7,8).
What are the key properties of 1-cyanobut-3-yn-2-yl hydrogen sulfite?
1-cyanobut-3-yn-2-yl hydrogen sulfite has a molecular weight of 159.17 g/mol, XLogP of 0.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyanobut-3-yn-2-yl hydrogen sulfite is sourced from PubChem (CID 150249313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).