About 4-cyanobutane-1-sulfinic acid
4-cyanobutane-1-sulfinic acid (PubChem CID 91036742) has the molecular formula C5H9NO2S
and a molecular weight of 147.20 g/mol. Its IUPAC name is 4-cyanobutane-1-sulfinic acid.
Molecular Properties
| Compound Name | 4-cyanobutane-1-sulfinic acid |
| PubChem CID | 91036742 |
| Molecular Formula | C5H9NO2S |
| Molecular Weight | 147.20 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | 4-cyanobutane-1-sulfinic acid |
| SMILES | N#CCCCCS(=O)O |
| InChI | InChI=1S/C5H9NO2S/c6-4-2-1-3-5-9(7)8/h1-3,5H2,(H,7,8) |
| InChIKey | YUJZBYUDYHIFES-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-cyanobutane-1-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyanobutane-1-sulfinic acid?
The IUPAC name of 4-cyanobutane-1-sulfinic acid (CID 91036742) is 4-cyanobutane-1-sulfinic acid.
What is the SMILES notation for 4-cyanobutane-1-sulfinic acid?
The canonical SMILES for 4-cyanobutane-1-sulfinic acid is N#CCCCCS(=O)O.
What is the InChIKey of 4-cyanobutane-1-sulfinic acid?
The InChIKey is YUJZBYUDYHIFES-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2S/c6-4-2-1-3-5-9(7)8/h1-3,5H2,(H,7,8).
What are the key properties of 4-cyanobutane-1-sulfinic acid?
4-cyanobutane-1-sulfinic acid has a molecular weight of 147.20 g/mol, XLogP of 0.90, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyanobutane-1-sulfinic acid is sourced from PubChem (CID 91036742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).