C14H19NOS — CID 79035594
5-[(3,5-dimethylphenyl)methylsulfinyl]pentanenitrile (PubChem CID 79035594) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is 5-[(3,5-dimethylphenyl)methylsulfinyl]pentanenitrile.
| Compound Name | 5-[(3,5-dimethylphenyl)methylsulfinyl]pentanenitrile |
|---|---|
| PubChem CID | 79035594 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 5-[(3,5-dimethylphenyl)methylsulfinyl]pentanenitrile |
| SMILES | Cc1cc(C)cc(CS(=O)CCCCC#N)c1 |
| InChI | InChI=1S/C14H19NOS/c1-12-8-13(2)10-14(9-12)11-17(16)7-5-3-4-6-15/h8-10H,3-5,7,11H2,1-2H3 |
| InChIKey | BGPAHTBQJISNNV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|