C14H11F6NO2S — CID 2739143
3-[3,5-bis(trifluoromethyl)phenyl]-2-propylsulfonylprop-2-enenitrile (PubChem CID 2739143) has the molecular formula C14H11F6NO2S and a molecular weight of 371.30 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-2-propylsulfonylprop-2-enenitrile.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-2-propylsulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 2739143 |
| Molecular Formula | C14H11F6NO2S |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-2-propylsulfonylprop-2-enenitrile |
| SMILES | CCCS(=O)(=O)C(C#N)=Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H11F6NO2S/c1-2-3-24(22,23)12(8-21)6-9-4-10(13(15,16)17)7-11(5-9)14(18,19)20/h4-7H,2-3H2,1H3 |
| InChIKey | QUOHUKPNGUVEED-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|