C18H13F4NO2S — CID 155517146
(E)-3-[2-fluoro-5-[[3-(trifluoromethyl)phenyl]methyl]phenyl]-2-methylsulfonylprop-2-enenitrile (PubChem CID 155517146) has the molecular formula C18H13F4NO2S and a molecular weight of 383.37 g/mol. Its IUPAC name is (E)-3-[2-fluoro-5-[[3-(trifluoromethyl)phenyl]methyl]phenyl]-2-methylsulfonylprop-2-enenitrile.
| Compound Name | (E)-3-[2-fluoro-5-[[3-(trifluoromethyl)phenyl]methyl]phenyl]-2-methylsulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 155517146 |
| Molecular Formula | C18H13F4NO2S |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | (E)-3-[2-fluoro-5-[[3-(trifluoromethyl)phenyl]methyl]phenyl]-2-methylsulfonylprop-2-enenitrile |
| SMILES | CS(=O)(=O)/C(C#N)=C/c1cc(Cc2cccc(C(F)(F)F)c2)ccc1F |
| InChI | InChI=1S/C18H13F4NO2S/c1-26(24,25)16(11-23)10-14-8-13(5-6-17(14)19)7-12-3-2-4-15(9-12)18(20,21)22/h2-6,8-10H,7H2,1H3/b16-10+ |
| InChIKey | WINIRGQQMURXDT-MHWRWJLKSA-N |
| XLogP | 4.34 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|