C18H12F5NO2S — CID 155531376
(E)-3-[2-fluoro-5-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]phenyl]-2-methylsulfonylprop-2-enenitrile (PubChem CID 155531376) has the molecular formula C18H12F5NO2S and a molecular weight of 401.36 g/mol. Its IUPAC name is (E)-3-[2-fluoro-5-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]phenyl]-2-methylsulfonylprop-2-enenitrile.
| Compound Name | (E)-3-[2-fluoro-5-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]phenyl]-2-methylsulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 155531376 |
| Molecular Formula | C18H12F5NO2S |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | (E)-3-[2-fluoro-5-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]phenyl]-2-methylsulfonylprop-2-enenitrile |
| SMILES | CS(=O)(=O)/C(C#N)=C/c1cc(Cc2ccc(C(F)(F)F)c(F)c2)ccc1F |
| InChI | InChI=1S/C18H12F5NO2S/c1-27(25,26)14(10-24)9-13-7-11(3-5-16(13)19)6-12-2-4-15(17(20)8-12)18(21,22)23/h2-5,7-9H,6H2,1H3/b14-9+ |
| InChIKey | BBAHEJVQSCARTM-NTEUORMPSA-N |
| XLogP | 4.48 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|