C17H12F3NO2S — CID 155545569
(E)-3-[5-[(3,4-difluorophenyl)methyl]-2-fluorophenyl]-2-methylsulfonylprop-2-enenitrile (PubChem CID 155545569) has the molecular formula C17H12F3NO2S and a molecular weight of 351.35 g/mol. Its IUPAC name is (E)-3-[5-[(3,4-difluorophenyl)methyl]-2-fluorophenyl]-2-methylsulfonylprop-2-enenitrile.
| Compound Name | (E)-3-[5-[(3,4-difluorophenyl)methyl]-2-fluorophenyl]-2-methylsulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 155545569 |
| Molecular Formula | C17H12F3NO2S |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | (E)-3-[5-[(3,4-difluorophenyl)methyl]-2-fluorophenyl]-2-methylsulfonylprop-2-enenitrile |
| SMILES | CS(=O)(=O)/C(C#N)=C/c1cc(Cc2ccc(F)c(F)c2)ccc1F |
| InChI | InChI=1S/C17H12F3NO2S/c1-24(22,23)14(10-21)9-13-7-11(2-4-15(13)18)6-12-3-5-16(19)17(20)8-12/h2-5,7-9H,6H2,1H3/b14-9+ |
| InChIKey | DMIMWPOSPGIOSO-NTEUORMPSA-N |
| XLogP | 3.60 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|