C18H13F4NO2S2 — CID 155545074
(E)-3-[2-fluoro-5-[[4-(trifluoromethylsulfanyl)phenyl]methyl]phenyl]-2-methylsulfonylprop-2-enenitrile (PubChem CID 155545074) has the molecular formula C18H13F4NO2S2 and a molecular weight of 415.43 g/mol. Its IUPAC name is (E)-3-[2-fluoro-5-[[4-(trifluoromethylsulfanyl)phenyl]methyl]phenyl]-2-methylsulfonylprop-2-enenitrile.
| Compound Name | (E)-3-[2-fluoro-5-[[4-(trifluoromethylsulfanyl)phenyl]methyl]phenyl]-2-methylsulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 155545074 |
| Molecular Formula | C18H13F4NO2S2 |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | (E)-3-[2-fluoro-5-[[4-(trifluoromethylsulfanyl)phenyl]methyl]phenyl]-2-methylsulfonylprop-2-enenitrile |
| SMILES | CS(=O)(=O)/C(C#N)=C/c1cc(Cc2ccc(SC(F)(F)F)cc2)ccc1F |
| InChI | InChI=1S/C18H13F4NO2S2/c1-27(24,25)16(11-23)10-14-9-13(4-7-17(14)19)8-12-2-5-15(6-3-12)26-18(20,21)22/h2-7,9-10H,8H2,1H3/b16-10+ |
| InChIKey | JIMDBOZJRFETPF-MHWRWJLKSA-N |
| XLogP | 4.94 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|