C11H15F5O2 — CID 150253257
2-[2-(2-ethyl-3,3,4,4,4-pentafluorobut-1-enoxy)ethyl]oxetane (PubChem CID 150253257) has the molecular formula C11H15F5O2 and a molecular weight of 274.23 g/mol. Its IUPAC name is 2-[2-(2-ethyl-3,3,4,4,4-pentafluorobut-1-enoxy)ethyl]oxetane.
| Compound Name | 2-[2-(2-ethyl-3,3,4,4,4-pentafluorobut-1-enoxy)ethyl]oxetane |
|---|---|
| PubChem CID | 150253257 |
| Molecular Formula | C11H15F5O2 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-[2-(2-ethyl-3,3,4,4,4-pentafluorobut-1-enoxy)ethyl]oxetane |
| SMILES | CCC(=COCCC1CCO1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H15F5O2/c1-2-8(10(12,13)11(14,15)16)7-17-5-3-9-4-6-18-9/h7,9H,2-6H2,1H3 |
| InChIKey | FZZYIWNNBPZAOS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|