C9H14F2O2 — CID 150190710
2,4-difluoro-2-[2-(2-methylprop-1-enoxy)ethyl]oxetane (PubChem CID 150190710) has the molecular formula C9H14F2O2 and a molecular weight of 192.20 g/mol. Its IUPAC name is 2,4-difluoro-2-[2-(2-methylprop-1-enoxy)ethyl]oxetane.
| Compound Name | 2,4-difluoro-2-[2-(2-methylprop-1-enoxy)ethyl]oxetane |
|---|---|
| PubChem CID | 150190710 |
| Molecular Formula | C9H14F2O2 |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 2,4-difluoro-2-[2-(2-methylprop-1-enoxy)ethyl]oxetane |
| SMILES | CC(C)=COCCC1(F)CC(F)O1 |
| InChI | InChI=1S/C9H14F2O2/c1-7(2)6-12-4-3-9(11)5-8(10)13-9/h6,8H,3-5H2,1-2H3 |
| InChIKey | FNJJVXWKGHMIRT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|