C8H12F2O2 — CID 151089497
2,3-difluoro-2-(2-prop-1-enoxyethyl)oxetane (PubChem CID 151089497) has the molecular formula C8H12F2O2 and a molecular weight of 178.18 g/mol. Its IUPAC name is 2,3-difluoro-2-(2-prop-1-enoxyethyl)oxetane.
| Compound Name | 2,3-difluoro-2-(2-prop-1-enoxyethyl)oxetane |
|---|---|
| PubChem CID | 151089497 |
| Molecular Formula | C8H12F2O2 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 2,3-difluoro-2-(2-prop-1-enoxyethyl)oxetane |
| SMILES | CC=COCCC1(F)OCC1F |
| InChI | InChI=1S/C8H12F2O2/c1-2-4-11-5-3-8(10)7(9)6-12-8/h2,4,7H,3,5-6H2,1H3 |
| InChIKey | MLVBLRMGYGUBOT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|