C21H24O5S — CID 150258049
3-oxo-6-[4-(2-phenylmethoxyethylsulfinyl)phenyl]hexanoic acid (PubChem CID 150258049) has the molecular formula C21H24O5S and a molecular weight of 388.49 g/mol. Its IUPAC name is 3-oxo-6-[4-(2-phenylmethoxyethylsulfinyl)phenyl]hexanoic acid.
| Compound Name | 3-oxo-6-[4-(2-phenylmethoxyethylsulfinyl)phenyl]hexanoic acid |
|---|---|
| PubChem CID | 150258049 |
| Molecular Formula | C21H24O5S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 3-oxo-6-[4-(2-phenylmethoxyethylsulfinyl)phenyl]hexanoic acid |
| SMILES | O=C(O)CC(=O)CCCc1ccc(S(=O)CCOCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H24O5S/c22-19(15-21(23)24)8-4-7-17-9-11-20(12-10-17)27(25)14-13-26-16-18-5-2-1-3-6-18/h1-3,5-6,9-12H,4,7-8,13-16H2,(H,23,24) |
| InChIKey | GAYXNCDPECWECN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|