About 2-(2-chlorophenyl)-2-(1,3-dioxolan-2-yl)-N-methylethanamine
2-(2-chlorophenyl)-2-(1,3-dioxolan-2-yl)-N-methylethanamine (PubChem CID 150261044) has the molecular formula C12H16ClNO2
and a molecular weight of 241.72 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2-(1,3-dioxolan-2-yl)-N-methylethanamine.
Molecular Properties
| Compound Name | 2-(2-chlorophenyl)-2-(1,3-dioxolan-2-yl)-N-methylethanamine |
| PubChem CID | 150261044 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-(2-chlorophenyl)-2-(1,3-dioxolan-2-yl)-N-methylethanamine |
| SMILES | CNCC(c1ccccc1Cl)C1OCCO1 |
| InChI | InChI=1S/C12H16ClNO2/c1-14-8-10(12-15-6-7-16-12)9-4-2-3-5-11(9)13/h2-5,10,12,14H,6-8H2,1H3 |
| InChIKey | GBOFLEAMKXCMLW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-chlorophenyl)-2-(1,3-dioxolan-2-yl)-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorophenyl)-2-(1,3-dioxolan-2-yl)-N-methylethanamine?
The IUPAC name of 2-(2-chlorophenyl)-2-(1,3-dioxolan-2-yl)-N-methylethanamine (CID 150261044) is 2-(2-chlorophenyl)-2-(1,3-dioxolan-2-yl)-N-methylethanamine.
What is the SMILES notation for 2-(2-chlorophenyl)-2-(1,3-dioxolan-2-yl)-N-methylethanamine?
The canonical SMILES for 2-(2-chlorophenyl)-2-(1,3-dioxolan-2-yl)-N-methylethanamine is CNCC(c1ccccc1Cl)C1OCCO1.
What is the InChIKey of 2-(2-chlorophenyl)-2-(1,3-dioxolan-2-yl)-N-methylethanamine?
The InChIKey is GBOFLEAMKXCMLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClNO2/c1-14-8-10(12-15-6-7-16-12)9-4-2-3-5-11(9)13/h2-5,10,12,14H,6-8H2,1H3.
What are the key properties of 2-(2-chlorophenyl)-2-(1,3-dioxolan-2-yl)-N-methylethanamine?
2-(2-chlorophenyl)-2-(1,3-dioxolan-2-yl)-N-methylethanamine has a molecular weight of 241.72 g/mol, XLogP of 2.02, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorophenyl)-2-(1,3-dioxolan-2-yl)-N-methylethanamine is sourced from PubChem (CID 150261044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).