C18H31NO2 — CID 150261138
tert-butyl 2-[(1S,5R,6R)-6-(aminomethyl)-3-tert-butyl-6-bicyclo[3.2.0]hept-3-enyl]acetate (PubChem CID 150261138) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is tert-butyl 2-[(1S,5R,6R)-6-(aminomethyl)-3-tert-butyl-6-bicyclo[3.2.0]hept-3-enyl]acetate.
| Compound Name | tert-butyl 2-[(1S,5R,6R)-6-(aminomethyl)-3-tert-butyl-6-bicyclo[3.2.0]hept-3-enyl]acetate |
|---|---|
| PubChem CID | 150261138 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | tert-butyl 2-[(1S,5R,6R)-6-(aminomethyl)-3-tert-butyl-6-bicyclo[3.2.0]hept-3-enyl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@]1(CN)C[C@@H]2CC(C(C)(C)C)=C[C@@H]21 |
| InChI | InChI=1S/C18H31NO2/c1-16(2,3)13-7-12-9-18(11-19,14(12)8-13)10-15(20)21-17(4,5)6/h8,12,14H,7,9-11,19H2,1-6H3/t12-,14-,18-/m0/s1 |
| InChIKey | GBOQFQALEGXUMY-YEWDVWPNSA-N |
| XLogP | 3.68 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|