About N-ethyl-7H-imidazo[4,5-b]pyridine-6-carboxamide
N-ethyl-7H-imidazo[4,5-b]pyridine-6-carboxamide (PubChem CID 150267600) has the molecular formula C9H10N4O
and a molecular weight of 190.21 g/mol. Its IUPAC name is N-ethyl-7H-imidazo[4,5-b]pyridine-6-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-7H-imidazo[4,5-b]pyridine-6-carboxamide |
| PubChem CID | 150267600 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | N-ethyl-7H-imidazo[4,5-b]pyridine-6-carboxamide |
| SMILES | CCNC(=O)C1=CN=C2N=CN=C2C1 |
| InChI | InChI=1S/C9H10N4O/c1-2-10-9(14)6-3-7-8(11-4-6)13-5-12-7/h4-5H,2-3H2,1H3,(H,10,14) |
| InChIKey | GCWIGYUGDBOXCN-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-7H-imidazo[4,5-b]pyridine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-7H-imidazo[4,5-b]pyridine-6-carboxamide?
The IUPAC name of N-ethyl-7H-imidazo[4,5-b]pyridine-6-carboxamide (CID 150267600) is N-ethyl-7H-imidazo[4,5-b]pyridine-6-carboxamide.
What is the SMILES notation for N-ethyl-7H-imidazo[4,5-b]pyridine-6-carboxamide?
The canonical SMILES for N-ethyl-7H-imidazo[4,5-b]pyridine-6-carboxamide is CCNC(=O)C1=CN=C2N=CN=C2C1.
What is the InChIKey of N-ethyl-7H-imidazo[4,5-b]pyridine-6-carboxamide?
The InChIKey is GCWIGYUGDBOXCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O/c1-2-10-9(14)6-3-7-8(11-4-6)13-5-12-7/h4-5H,2-3H2,1H3,(H,10,14).
What are the key properties of N-ethyl-7H-imidazo[4,5-b]pyridine-6-carboxamide?
N-ethyl-7H-imidazo[4,5-b]pyridine-6-carboxamide has a molecular weight of 190.21 g/mol, XLogP of 0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-7H-imidazo[4,5-b]pyridine-6-carboxamide is sourced from PubChem (CID 150267600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).