C9H15N3O — CID 83875791
5-(3-aminopropyl)-2,3-dimethylpyrimidin-4-one (PubChem CID 83875791) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 5-(3-aminopropyl)-2,3-dimethylpyrimidin-4-one.
| Compound Name | 5-(3-aminopropyl)-2,3-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 83875791 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 5-(3-aminopropyl)-2,3-dimethylpyrimidin-4-one |
| SMILES | Cc1ncc(CCCN)c(=O)n1C |
| InChI | InChI=1S/C9H15N3O/c1-7-11-6-8(4-3-5-10)9(13)12(7)2/h6H,3-5,10H2,1-2H3 |
| InChIKey | UGXHHQLBZCJGRV-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |