C24H30BrF3N4O — CID 150280948
N-[4-[4-(4-bromophenyl)piperazin-1-yl]phenyl]-2-(tert-butylamino)-4,4,4-trifluorobutanamide (PubChem CID 150280948) has the molecular formula C24H30BrF3N4O and a molecular weight of 527.43 g/mol. Its IUPAC name is N-[4-[4-(4-bromophenyl)piperazin-1-yl]phenyl]-2-(tert-butylamino)-4,4,4-trifluorobutanamide.
| Compound Name | N-[4-[4-(4-bromophenyl)piperazin-1-yl]phenyl]-2-(tert-butylamino)-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 150280948 |
| Molecular Formula | C24H30BrF3N4O |
| Molecular Weight | 527.43 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | N-[4-[4-(4-bromophenyl)piperazin-1-yl]phenyl]-2-(tert-butylamino)-4,4,4-trifluorobutanamide |
| SMILES | CC(C)(C)NC(CC(F)(F)F)C(=O)Nc1ccc(N2CCN(c3ccc(Br)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H30BrF3N4O/c1-23(2,3)30-21(16-24(26,27)28)22(33)29-18-6-10-20(11-7-18)32-14-12-31(13-15-32)19-8-4-17(25)5-9-19/h4-11,21,30H,12-16H2,1-3H3,(H,29,33) |
| InChIKey | ZXWMQAIFBMOUSS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.43 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|