About (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-4-(oxan-2-yl)but-2-en-1-one
(E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-4-(oxan-2-yl)but-2-en-1-one (PubChem CID 150291971) has the molecular formula C13H15Cl2N3O2
and a molecular weight of 316.19 g/mol. Its IUPAC name is (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-4-(oxan-2-yl)but-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-4-(oxan-2-yl)but-2-en-1-one |
| PubChem CID | 150291971 |
| Molecular Formula | C13H15Cl2N3O2 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-4-(oxan-2-yl)but-2-en-1-one |
| SMILES | Nc1nc(Cl)c(C(=O)/C=C/CC2CCCCO2)c(Cl)n1 |
| InChI | InChI=1S/C13H15Cl2N3O2/c14-11-10(12(15)18-13(16)17-11)9(19)6-3-5-8-4-1-2-7-20-8/h3,6,8H,1-2,4-5,7H2,(H2,16,17,18)/b6-3+ |
| InChIKey | GHTWMXHMPIQAPH-ZZXKWVIFSA-N |
| XLogP | 3.06 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-4-(oxan-2-yl)but-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-4-(oxan-2-yl)but-2-en-1-one?
The IUPAC name of (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-4-(oxan-2-yl)but-2-en-1-one (CID 150291971) is (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-4-(oxan-2-yl)but-2-en-1-one.
What is the SMILES notation for (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-4-(oxan-2-yl)but-2-en-1-one?
The canonical SMILES for (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-4-(oxan-2-yl)but-2-en-1-one is Nc1nc(Cl)c(C(=O)/C=C/CC2CCCCO2)c(Cl)n1.
What is the InChIKey of (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-4-(oxan-2-yl)but-2-en-1-one?
The InChIKey is GHTWMXHMPIQAPH-ZZXKWVIFSA-N. The full InChI is InChI=1S/C13H15Cl2N3O2/c14-11-10(12(15)18-13(16)17-11)9(19)6-3-5-8-4-1-2-7-20-8/h3,6,8H,1-2,4-5,7H2,(H2,16,17,18)/b6-3+.
What are the key properties of (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-4-(oxan-2-yl)but-2-en-1-one?
(E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-4-(oxan-2-yl)but-2-en-1-one has a molecular weight of 316.19 g/mol, XLogP of 3.06, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-4-(oxan-2-yl)but-2-en-1-one is sourced from PubChem (CID 150291971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).