C20H42N2 — CID 15030022
2,8-dimethyl-N-(4-piperidin-1-ylbutyl)nonan-5-amine (PubChem CID 15030022) has the molecular formula C20H42N2 and a molecular weight of 310.57 g/mol. Its IUPAC name is 2,8-dimethyl-N-(4-piperidin-1-ylbutyl)nonan-5-amine.
| Compound Name | 2,8-dimethyl-N-(4-piperidin-1-ylbutyl)nonan-5-amine |
|---|---|
| PubChem CID | 15030022 |
| Molecular Formula | C20H42N2 |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 310.33 |
| IUPAC Name | 2,8-dimethyl-N-(4-piperidin-1-ylbutyl)nonan-5-amine |
| SMILES | CC(C)CCC(CCC(C)C)NCCCCN1CCCCC1 |
| InChI | InChI=1S/C20H42N2/c1-18(2)10-12-20(13-11-19(3)4)21-14-6-9-17-22-15-7-5-8-16-22/h18-21H,5-17H2,1-4H3 |
| InChIKey | TZOKBNKJKFFUAD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|