C22H47N3 — CID 70378610
2,8-dimethyl-N-(7-piperazin-1-ylheptyl)nonan-5-amine (PubChem CID 70378610) has the molecular formula C22H47N3 and a molecular weight of 353.64 g/mol. Its IUPAC name is 2,8-dimethyl-N-(7-piperazin-1-ylheptyl)nonan-5-amine.
| Compound Name | 2,8-dimethyl-N-(7-piperazin-1-ylheptyl)nonan-5-amine |
|---|---|
| PubChem CID | 70378610 |
| Molecular Formula | C22H47N3 |
| Molecular Weight | 353.64 g/mol |
| Exact Mass | 353.38 |
| IUPAC Name | 2,8-dimethyl-N-(7-piperazin-1-ylheptyl)nonan-5-amine |
| SMILES | CC(C)CCC(CCC(C)C)NCCCCCCCN1CCNCC1 |
| InChI | InChI=1S/C22H47N3/c1-20(2)10-12-22(13-11-21(3)4)24-14-8-6-5-7-9-17-25-18-15-23-16-19-25/h20-24H,5-19H2,1-4H3 |
| InChIKey | ATEZIBPNLLTPDQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.64 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|