About 1,2-diaminopyrazolidine-3,5-dione
1,2-diaminopyrazolidine-3,5-dione (PubChem CID 150306808) has the molecular formula C3H6N4O2
and a molecular weight of 130.11 g/mol. Its IUPAC name is 1,2-diaminopyrazolidine-3,5-dione.
Molecular Properties
| Compound Name | 1,2-diaminopyrazolidine-3,5-dione |
| PubChem CID | 150306808 |
| Molecular Formula | C3H6N4O2 |
| Molecular Weight | 130.11 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | 1,2-diaminopyrazolidine-3,5-dione |
| SMILES | NN1C(=O)CC(=O)N1N |
| InChI | InChI=1S/C3H6N4O2/c4-6-2(8)1-3(9)7(6)5/h1,4-5H2 |
| InChIKey | GKTSEDYLEXADDL-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.11 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diaminopyrazolidine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diaminopyrazolidine-3,5-dione?
The IUPAC name of 1,2-diaminopyrazolidine-3,5-dione (CID 150306808) is 1,2-diaminopyrazolidine-3,5-dione.
What is the SMILES notation for 1,2-diaminopyrazolidine-3,5-dione?
The canonical SMILES for 1,2-diaminopyrazolidine-3,5-dione is NN1C(=O)CC(=O)N1N.
What is the InChIKey of 1,2-diaminopyrazolidine-3,5-dione?
The InChIKey is GKTSEDYLEXADDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N4O2/c4-6-2(8)1-3(9)7(6)5/h1,4-5H2.
What are the key properties of 1,2-diaminopyrazolidine-3,5-dione?
1,2-diaminopyrazolidine-3,5-dione has a molecular weight of 130.11 g/mol, XLogP of -2.29, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diaminopyrazolidine-3,5-dione is sourced from PubChem (CID 150306808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).