C22H19N8+ — CID 150313235
4-(benzotriazol-1-yl)-N-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)phenyl]pyridin-1-ium-1-amine (PubChem CID 150313235) has the molecular formula C22H19N8+ and a molecular weight of 395.45 g/mol. Its IUPAC name is 4-(benzotriazol-1-yl)-N-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)phenyl]pyridin-1-ium-1-amine.
| Compound Name | 4-(benzotriazol-1-yl)-N-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)phenyl]pyridin-1-ium-1-amine |
|---|---|
| PubChem CID | 150313235 |
| Molecular Formula | C22H19N8+ |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 4-(benzotriazol-1-yl)-N-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)phenyl]pyridin-1-ium-1-amine |
| SMILES | c1cc(N[n+]2ccc(-n3nnc4ccccc43)cc2)cc(-c2nncn2C2CC2)c1 |
| InChI | InChI=1S/C22H19N8/c1-2-7-21-20(6-1)24-27-30(21)19-10-12-28(13-11-19)26-17-5-3-4-16(14-17)22-25-23-15-29(22)18-8-9-18/h1-7,10-15,18,26H,8-9H2/q+1 |
| InChIKey | GMBJWHQWTGULRR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|