C25H22N7+ — CID 151538540
N-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)phenyl]-4-(4-phenylimidazol-1-yl)pyridin-1-ium-1-amine (PubChem CID 151538540) has the molecular formula C25H22N7+ and a molecular weight of 420.50 g/mol. Its IUPAC name is N-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)phenyl]-4-(4-phenylimidazol-1-yl)pyridin-1-ium-1-amine.
| Compound Name | N-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)phenyl]-4-(4-phenylimidazol-1-yl)pyridin-1-ium-1-amine |
|---|---|
| PubChem CID | 151538540 |
| Molecular Formula | C25H22N7+ |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | N-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)phenyl]-4-(4-phenylimidazol-1-yl)pyridin-1-ium-1-amine |
| SMILES | c1ccc(-c2cn(-c3cc[n+](Nc4cccc(-c5nncn5C5CC5)c4)cc3)cn2)cc1 |
| InChI | InChI=1S/C25H22N7/c1-2-5-19(6-3-1)24-16-30(17-26-24)22-11-13-31(14-12-22)29-21-8-4-7-20(15-21)25-28-27-18-32(25)23-9-10-23/h1-8,11-18,23,29H,9-10H2/q+1 |
| InChIKey | PXZDWUZXFKGYJK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|