C25H21N6+ — CID 150324259
4-(4-cyclopropylimidazol-1-yl)-1-[3-(4-phenyl-1,2,4-triazol-3-yl)phenyl]pyridin-1-ium (PubChem CID 150324259) has the molecular formula C25H21N6+ and a molecular weight of 405.49 g/mol. Its IUPAC name is 4-(4-cyclopropylimidazol-1-yl)-1-[3-(4-phenyl-1,2,4-triazol-3-yl)phenyl]pyridin-1-ium.
| Compound Name | 4-(4-cyclopropylimidazol-1-yl)-1-[3-(4-phenyl-1,2,4-triazol-3-yl)phenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 150324259 |
| Molecular Formula | C25H21N6+ |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 4-(4-cyclopropylimidazol-1-yl)-1-[3-(4-phenyl-1,2,4-triazol-3-yl)phenyl]pyridin-1-ium |
| SMILES | c1ccc(-n2cnnc2-c2cccc(-[n+]3ccc(-n4cnc(C5CC5)c4)cc3)c2)cc1 |
| InChI | InChI=1S/C25H21N6/c1-2-6-22(7-3-1)31-18-27-28-25(31)20-5-4-8-23(15-20)29-13-11-21(12-14-29)30-16-24(26-17-30)19-9-10-19/h1-8,11-19H,9-10H2/q+1 |
| InChIKey | GOHHFXZQFMBFTM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|