C18H41N3 — CID 150318473
N-(hexylamino)-3,3-dimethyl-N-(4-methylpentan-2-ylamino)butan-1-amine (PubChem CID 150318473) has the molecular formula C18H41N3 and a molecular weight of 299.55 g/mol. Its IUPAC name is N-(hexylamino)-3,3-dimethyl-N-(4-methylpentan-2-ylamino)butan-1-amine.
| Compound Name | N-(hexylamino)-3,3-dimethyl-N-(4-methylpentan-2-ylamino)butan-1-amine |
|---|---|
| PubChem CID | 150318473 |
| Molecular Formula | C18H41N3 |
| Molecular Weight | 299.55 g/mol |
| Exact Mass | 299.33 |
| IUPAC Name | N-(hexylamino)-3,3-dimethyl-N-(4-methylpentan-2-ylamino)butan-1-amine |
| SMILES | CCCCCCNN(CCC(C)(C)C)NC(C)CC(C)C |
| InChI | InChI=1S/C18H41N3/c1-8-9-10-11-13-19-21(14-12-18(5,6)7)20-17(4)15-16(2)3/h16-17,19-20H,8-15H2,1-7H3 |
| InChIKey | GNCMETWBHHOKNR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|