C8H14N2O — CID 150321493
N-(1-methyl-8-azabicyclo[3.2.1]octan-3-ylidene)hydroxylamine (PubChem CID 150321493) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is N-(1-methyl-8-azabicyclo[3.2.1]octan-3-ylidene)hydroxylamine.
| Compound Name | N-(1-methyl-8-azabicyclo[3.2.1]octan-3-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 150321493 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | N-(1-methyl-8-azabicyclo[3.2.1]octan-3-ylidene)hydroxylamine |
| SMILES | CC12CCC(CC(=NO)C1)N2 |
| InChI | InChI=1S/C8H14N2O/c1-8-3-2-6(9-8)4-7(5-8)10-11/h6,9,11H,2-5H2,1H3 |
| InChIKey | GNSPITWQXVTIHE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|