C11H18N2O4 — CID 15262063
N-(7-hydroxyimino-9,9-dimethoxy-3-bicyclo[3.3.1]nonanylidene)hydroxylamine (PubChem CID 15262063) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is N-(7-hydroxyimino-9,9-dimethoxy-3-bicyclo[3.3.1]nonanylidene)hydroxylamine.
| Compound Name | N-(7-hydroxyimino-9,9-dimethoxy-3-bicyclo[3.3.1]nonanylidene)hydroxylamine |
|---|---|
| PubChem CID | 15262063 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | N-(7-hydroxyimino-9,9-dimethoxy-3-bicyclo[3.3.1]nonanylidene)hydroxylamine |
| SMILES | COC1(OC)C2CC(=NO)CC1CC(=NO)C2 |
| InChI | InChI=1S/C11H18N2O4/c1-16-11(17-2)7-3-9(12-14)5-8(11)6-10(4-7)13-15/h7-8,14-15H,3-6H2,1-2H3/b12-9-,13-10- |
| InChIKey | KBJZKCAVRNKIFL-QKFASICWSA-N |
| XLogP | 1.46 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|