C8H13NO3 — CID 118162231
methyl (3Z)-3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate (PubChem CID 118162231) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is methyl (3Z)-3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate.
| Compound Name | methyl (3Z)-3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 118162231 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | methyl (3Z)-3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate |
| SMILES | COC(=O)C1C/C(=N/O)C1(C)C |
| InChI | InChI=1S/C8H13NO3/c1-8(2)5(7(10)12-3)4-6(8)9-11/h5,11H,4H2,1-3H3/b9-6- |
| InChIKey | KFUSTBHUVWNFHM-TWGQIWQCSA-N |
| XLogP | 1.04 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|