C24H42O8 — CID 150322202
8,10-bis(methoxycarbonyl)-2,3,5,5,8,10,12-heptamethyltridecanedioic acid (PubChem CID 150322202) has the molecular formula C24H42O8 and a molecular weight of 458.59 g/mol. Its IUPAC name is 8,10-bis(methoxycarbonyl)-2,3,5,5,8,10,12-heptamethyltridecanedioic acid.
| Compound Name | 8,10-bis(methoxycarbonyl)-2,3,5,5,8,10,12-heptamethyltridecanedioic acid |
|---|---|
| PubChem CID | 150322202 |
| Molecular Formula | C24H42O8 |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | 8,10-bis(methoxycarbonyl)-2,3,5,5,8,10,12-heptamethyltridecanedioic acid |
| SMILES | COC(=O)C(C)(CCC(C)(C)CC(C)C(C)C(=O)O)CC(C)(CC(C)C(=O)O)C(=O)OC |
| InChI | InChI=1S/C24H42O8/c1-15(17(3)19(27)28)12-22(4,5)10-11-23(6,20(29)31-8)14-24(7,21(30)32-9)13-16(2)18(25)26/h15-17H,10-14H2,1-9H3,(H,25,26)(H,27,28) |
| InChIKey | GNWLDDONGFHYIP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |