C19H32O8 — CID 21185462
4,6-bis(methoxycarbonyl)-2,4,6-trimethyldodecanedioic acid (PubChem CID 21185462) has the molecular formula C19H32O8 and a molecular weight of 388.46 g/mol. Its IUPAC name is 4,6-bis(methoxycarbonyl)-2,4,6-trimethyldodecanedioic acid.
| Compound Name | 4,6-bis(methoxycarbonyl)-2,4,6-trimethyldodecanedioic acid |
|---|---|
| PubChem CID | 21185462 |
| Molecular Formula | C19H32O8 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 4,6-bis(methoxycarbonyl)-2,4,6-trimethyldodecanedioic acid |
| SMILES | COC(=O)C(C)(CCCCCC(=O)O)CC(C)(CC(C)C(=O)O)C(=O)OC |
| InChI | InChI=1S/C19H32O8/c1-13(15(22)23)11-19(3,17(25)27-5)12-18(2,16(24)26-4)10-8-6-7-9-14(20)21/h13H,6-12H2,1-5H3,(H,20,21)(H,22,23) |
| InChIKey | XRJQXMTWLQVPKY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|