About 2,5-dihydro-1H-[1,3]thiazolo[3,2-a]quinoline-4-carboxylic acid
2,5-dihydro-1H-[1,3]thiazolo[3,2-a]quinoline-4-carboxylic acid (PubChem CID 150324802) has the molecular formula C12H11NO2S
and a molecular weight of 233.29 g/mol. Its IUPAC name is 2,5-dihydro-1H-[1,3]thiazolo[3,2-a]quinoline-4-carboxylic acid.
Analyze 2,5-dihydro-1H-[1,3]thiazolo[3,2-a]quinoline-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dihydro-1H-[1,3]thiazolo[3,2-a]quinoline-4-carboxylic acid?
The IUPAC name of 2,5-dihydro-1H-[1,3]thiazolo[3,2-a]quinoline-4-carboxylic acid (CID 150324802) is 2,5-dihydro-1H-[1,3]thiazolo[3,2-a]quinoline-4-carboxylic acid.
What is the SMILES notation for 2,5-dihydro-1H-[1,3]thiazolo[3,2-a]quinoline-4-carboxylic acid?
The canonical SMILES for 2,5-dihydro-1H-[1,3]thiazolo[3,2-a]quinoline-4-carboxylic acid is O=C(O)C1=C2SCCN2c2ccccc2C1.
What is the InChIKey of 2,5-dihydro-1H-[1,3]thiazolo[3,2-a]quinoline-4-carboxylic acid?
The InChIKey is GOKBNQNLQPLTEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2S/c14-12(15)9-7-8-3-1-2-4-10(8)13-5-6-16-11(9)13/h1-4H,5-7H2,(H,14,15).
What are the key properties of 2,5-dihydro-1H-[1,3]thiazolo[3,2-a]quinoline-4-carboxylic acid?
2,5-dihydro-1H-[1,3]thiazolo[3,2-a]quinoline-4-carboxylic acid has a molecular weight of 233.29 g/mol, XLogP of 2.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dihydro-1H-[1,3]thiazolo[3,2-a]quinoline-4-carboxylic acid is sourced from PubChem (CID 150324802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).