About (4-azidophenyl) formate
(4-azidophenyl) formate (PubChem CID 150326608) has the molecular formula C7H5N3O2
and a molecular weight of 163.14 g/mol. Its IUPAC name is (4-azidophenyl) formate.
Molecular Properties
| Compound Name | (4-azidophenyl) formate |
| PubChem CID | 150326608 |
| Molecular Formula | C7H5N3O2 |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | (4-azidophenyl) formate |
| SMILES | [N-]=[N+]=Nc1ccc(OC=O)cc1 |
| InChI | InChI=1S/C7H5N3O2/c8-10-9-6-1-3-7(4-2-6)12-5-11/h1-5H |
| InChIKey | GOTXWGXZLKSFCB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (4-azidophenyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-azidophenyl) formate?
The IUPAC name of (4-azidophenyl) formate (CID 150326608) is (4-azidophenyl) formate.
What is the SMILES notation for (4-azidophenyl) formate?
The canonical SMILES for (4-azidophenyl) formate is [N-]=[N+]=Nc1ccc(OC=O)cc1.
What is the InChIKey of (4-azidophenyl) formate?
The InChIKey is GOTXWGXZLKSFCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2/c8-10-9-6-1-3-7(4-2-6)12-5-11/h1-5H.
What are the key properties of (4-azidophenyl) formate?
(4-azidophenyl) formate has a molecular weight of 163.14 g/mol, XLogP of 2.16, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-azidophenyl) formate is sourced from PubChem (CID 150326608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).