C15H28N4+2 — CID 150338618
1,1-dibutyl-3-(1H-imidazol-3-ium-3-ylmethyl)-2H-imidazol-1-ium (PubChem CID 150338618) has the molecular formula C15H28N4+2 and a molecular weight of 264.42 g/mol. Its IUPAC name is 1,1-dibutyl-3-(1H-imidazol-3-ium-3-ylmethyl)-2H-imidazol-1-ium.
| Compound Name | 1,1-dibutyl-3-(1H-imidazol-3-ium-3-ylmethyl)-2H-imidazol-1-ium |
|---|---|
| PubChem CID | 150338618 |
| Molecular Formula | C15H28N4+2 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | 1,1-dibutyl-3-(1H-imidazol-3-ium-3-ylmethyl)-2H-imidazol-1-ium |
| SMILES | CCCC[N+]1(CCCC)C=CN(C[n+]2cc[nH]c2)C1 |
| InChI | InChI=1S/C15H27N4/c1-3-5-10-19(11-6-4-2)12-9-18(15-19)14-17-8-7-16-13-17/h7-9,12-13H,3-6,10-11,14-15H2,1-2H3/q+1/p+1 |
| InChIKey | GRFDQRMCOSPDOB-UHFFFAOYSA-O |
| XLogP | 2.42 |
| TPSA | 22.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|