C13H25N2O2+ — CID 139327100
2-(1,3-dibutyl-2H-imidazol-1-ium-1-yl)acetic acid (PubChem CID 139327100) has the molecular formula C13H25N2O2+ and a molecular weight of 241.35 g/mol. Its IUPAC name is 2-(1,3-dibutyl-2H-imidazol-1-ium-1-yl)acetic acid.
| Compound Name | 2-(1,3-dibutyl-2H-imidazol-1-ium-1-yl)acetic acid |
|---|---|
| PubChem CID | 139327100 |
| Molecular Formula | C13H25N2O2+ |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | 2-(1,3-dibutyl-2H-imidazol-1-ium-1-yl)acetic acid |
| SMILES | CCCCN1C=C[N+](CCCC)(CC(=O)O)C1 |
| InChI | InChI=1S/C13H24N2O2/c1-3-5-7-14-8-10-15(12-14,9-6-4-2)11-13(16)17/h8,10H,3-7,9,11-12H2,1-2H3/p+1 |
| InChIKey | ABXBHUHBOUUYKV-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|