C19H37BF4N4O2 — CID 141096076
N-ethyl-2-[3-[2-(ethylamino)-2-oxoethyl]-3-octyl-2H-imidazol-3-ium-1-yl]acetamide tetrafluoroborate (PubChem CID 141096076) has the molecular formula C19H37BF4N4O2 and a molecular weight of 440.34 g/mol. Its IUPAC name is N-ethyl-2-[3-[2-(ethylamino)-2-oxoethyl]-3-octyl-2H-imidazol-3-ium-1-yl]acetamide tetrafluoroborate.
| Compound Name | N-ethyl-2-[3-[2-(ethylamino)-2-oxoethyl]-3-octyl-2H-imidazol-3-ium-1-yl]acetamide tetrafluoroborate |
|---|---|
| PubChem CID | 141096076 |
| Molecular Formula | C19H37BF4N4O2 |
| Molecular Weight | 440.34 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | N-ethyl-2-[3-[2-(ethylamino)-2-oxoethyl]-3-octyl-2H-imidazol-3-ium-1-yl]acetamide tetrafluoroborate |
| SMILES | CCCCCCCC[N+]1(CC(=O)NCC)C=CN(CC(=O)NCC)C1.F[B-](F)(F)F |
| InChI | InChI=1S/C19H36N4O2.BF4/c1-4-7-8-9-10-11-13-23(16-19(25)21-6-3)14-12-22(17-23)15-18(24)20-5-2;2-1(3,4)5/h12,14H,4-11,13,15-17H2,1-3H3,(H-,20,21,24,25);/q;-1/p+1 |
| InChIKey | HKXQNEIHTSTCKB-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|