C10H21N4O+ — CID 174949136
(3-methyl-1-pentyl-2H-imidazol-1-ium-1-yl)urea (PubChem CID 174949136) has the molecular formula C10H21N4O+ and a molecular weight of 213.30 g/mol. Its IUPAC name is (3-methyl-1-pentyl-2H-imidazol-1-ium-1-yl)urea.
| Compound Name | (3-methyl-1-pentyl-2H-imidazol-1-ium-1-yl)urea |
|---|---|
| PubChem CID | 174949136 |
| Molecular Formula | C10H21N4O+ |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | (3-methyl-1-pentyl-2H-imidazol-1-ium-1-yl)urea |
| SMILES | CCCCC[N+]1(NC(N)=O)C=CN(C)C1 |
| InChI | InChI=1S/C10H20N4O/c1-3-4-5-7-14(12-10(11)15)8-6-13(2)9-14/h6,8H,3-5,7,9H2,1-2H3,(H2-,11,12,15)/p+1 |
| InChIKey | XMEPGEQPNVSSBU-UHFFFAOYSA-O |
| XLogP | 0.95 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|