C10H19N4O2+ — CID 175870516
3-butyl-1-methyl-2H-imidazol-1-ium-1,2-dicarboxamide (PubChem CID 175870516) has the molecular formula C10H19N4O2+ and a molecular weight of 227.29 g/mol. Its IUPAC name is 3-butyl-1-methyl-2H-imidazol-1-ium-1,2-dicarboxamide.
| Compound Name | 3-butyl-1-methyl-2H-imidazol-1-ium-1,2-dicarboxamide |
|---|---|
| PubChem CID | 175870516 |
| Molecular Formula | C10H19N4O2+ |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 3-butyl-1-methyl-2H-imidazol-1-ium-1,2-dicarboxamide |
| SMILES | CCCCN1C=C[N+](C)(C(N)=O)C1C(N)=O |
| InChI | InChI=1S/C10H18N4O2/c1-3-4-5-13-6-7-14(2,10(12)16)9(13)8(11)15/h6-7,9H,3-5H2,1-2H3,(H3-,11,12,15,16)/p+1 |
| InChIKey | WFYXCUSUPAHZAP-UHFFFAOYSA-O |
| XLogP | -0.09 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|