About 2-chloro-5-(4,4-difluorobut-3-enyl)-1,3-thiazole
2-chloro-5-(4,4-difluorobut-3-enyl)-1,3-thiazole (PubChem CID 150341390) has the molecular formula C7H6ClF2NS
and a molecular weight of 209.65 g/mol. Its IUPAC name is 2-chloro-5-(4,4-difluorobut-3-enyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-chloro-5-(4,4-difluorobut-3-enyl)-1,3-thiazole |
| PubChem CID | 150341390 |
| Molecular Formula | C7H6ClF2NS |
| Molecular Weight | 209.65 g/mol |
| Exact Mass | 208.99 |
| IUPAC Name | 2-chloro-5-(4,4-difluorobut-3-enyl)-1,3-thiazole |
| SMILES | FC(F)=CCCc1cnc(Cl)s1 |
| InChI | InChI=1S/C7H6ClF2NS/c8-7-11-4-5(12-7)2-1-3-6(9)10/h3-4H,1-2H2 |
| InChIKey | GRTYOROPUPSFBZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.65 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-5-(4,4-difluorobut-3-enyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(4,4-difluorobut-3-enyl)-1,3-thiazole?
The IUPAC name of 2-chloro-5-(4,4-difluorobut-3-enyl)-1,3-thiazole (CID 150341390) is 2-chloro-5-(4,4-difluorobut-3-enyl)-1,3-thiazole.
What is the SMILES notation for 2-chloro-5-(4,4-difluorobut-3-enyl)-1,3-thiazole?
The canonical SMILES for 2-chloro-5-(4,4-difluorobut-3-enyl)-1,3-thiazole is FC(F)=CCCc1cnc(Cl)s1.
What is the InChIKey of 2-chloro-5-(4,4-difluorobut-3-enyl)-1,3-thiazole?
The InChIKey is GRTYOROPUPSFBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClF2NS/c8-7-11-4-5(12-7)2-1-3-6(9)10/h3-4H,1-2H2.
What are the key properties of 2-chloro-5-(4,4-difluorobut-3-enyl)-1,3-thiazole?
2-chloro-5-(4,4-difluorobut-3-enyl)-1,3-thiazole has a molecular weight of 209.65 g/mol, XLogP of 3.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(4,4-difluorobut-3-enyl)-1,3-thiazole is sourced from PubChem (CID 150341390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).