C7H6ClF2NS — CID 150341390
2-chloro-5-(4,4-difluorobut-3-enyl)-1,3-thiazole (PubChem CID 150341390) has the molecular formula C7H6ClF2NS and a molecular weight of 209.65 g/mol. Its IUPAC name is 2-chloro-5-(4,4-difluorobut-3-enyl)-1,3-thiazole.
| Compound Name | 2-chloro-5-(4,4-difluorobut-3-enyl)-1,3-thiazole |
|---|---|
| PubChem CID | 150341390 |
| Molecular Formula | C7H6ClF2NS |
| Molecular Weight | 209.65 g/mol |
| Exact Mass | 208.99 |
| IUPAC Name | 2-chloro-5-(4,4-difluorobut-3-enyl)-1,3-thiazole |
| SMILES | FC(F)=CCCc1cnc(Cl)s1 |
| InChI | InChI=1S/C7H6ClF2NS/c8-7-11-4-5(12-7)2-1-3-6(9)10/h3-4H,1-2H2 |
| InChIKey | GRTYOROPUPSFBZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.65 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |