C17H18Cl2N2O — CID 150348366
2,4-bis(6-chloro-5-methyl-2-pyridinyl)pentan-3-one (PubChem CID 150348366) has the molecular formula C17H18Cl2N2O and a molecular weight of 337.25 g/mol. Its IUPAC name is 2,4-bis(6-chloro-5-methyl-2-pyridinyl)pentan-3-one.
| Compound Name | 2,4-bis(6-chloro-5-methyl-2-pyridinyl)pentan-3-one |
|---|---|
| PubChem CID | 150348366 |
| Molecular Formula | C17H18Cl2N2O |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2,4-bis(6-chloro-5-methyl-2-pyridinyl)pentan-3-one |
| SMILES | Cc1ccc(C(C)C(=O)C(C)c2ccc(C)c(Cl)n2)nc1Cl |
| InChI | InChI=1S/C17H18Cl2N2O/c1-9-5-7-13(20-16(9)18)11(3)15(22)12(4)14-8-6-10(2)17(19)21-14/h5-8,11-12H,1-4H3 |
| InChIKey | GTEZARUDWQFBGT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|