C10H15ClN2O — CID 170981052
6-chloro-N,5-dimethylpyridine-2-carboxamide;ethane (PubChem CID 170981052) has the molecular formula C10H15ClN2O and a molecular weight of 214.70 g/mol. Its IUPAC name is 6-chloro-N,5-dimethylpyridine-2-carboxamide;ethane.
| Compound Name | 6-chloro-N,5-dimethylpyridine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 170981052 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 6-chloro-N,5-dimethylpyridine-2-carboxamide;ethane |
| SMILES | CC.CNC(=O)c1ccc(C)c(Cl)n1 |
| InChI | InChI=1S/C8H9ClN2O.C2H6/c1-5-3-4-6(8(12)10-2)11-7(5)9;1-2/h3-4H,1-2H3,(H,10,12);1-2H3 |
| InChIKey | NMLDZZJEHYBZDQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|