C9H9N3O — CID 170981219
6-cyano-N,5-dimethylpyridine-2-carboxamide (PubChem CID 170981219) has the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. Its IUPAC name is 6-cyano-N,5-dimethylpyridine-2-carboxamide.
| Compound Name | 6-cyano-N,5-dimethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 170981219 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 6-cyano-N,5-dimethylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(C)c(C#N)n1 |
| InChI | InChI=1S/C9H9N3O/c1-6-3-4-7(9(13)11-2)12-8(6)5-10/h3-4H,1-2H3,(H,11,13) |
| InChIKey | UZAHPBBYWCFNDE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |