C15H28 — CID 150348371
3,3,4,4,5,5,6,6-octadeuterio-1-nonylcyclohexene (PubChem CID 150348371) has the molecular formula C15H28 and a molecular weight of 216.44 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6-octadeuterio-1-nonylcyclohexene.
| Compound Name | 3,3,4,4,5,5,6,6-octadeuterio-1-nonylcyclohexene |
|---|---|
| PubChem CID | 150348371 |
| Molecular Formula | C15H28 |
| Molecular Weight | 216.44 g/mol |
| Exact Mass | 216.27 |
| IUPAC Name | 3,3,4,4,5,5,6,6-octadeuterio-1-nonylcyclohexene |
| SMILES | [2H]C1([2H])C=C(CCCCCCCCC)C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C15H28/c1-2-3-4-5-6-7-9-12-15-13-10-8-11-14-15/h13H,2-12,14H2,1H3/i8D2,10D2,11D2,14D2 |
| InChIKey | GTEZIRITHHEDAC-XAIDPZFNSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.44 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|