C18H32 — CID 175939867
1-nonyl-4-prop-2-enylcyclohexene (PubChem CID 175939867) has the molecular formula C18H32 and a molecular weight of 248.45 g/mol. Its IUPAC name is 1-nonyl-4-prop-2-enylcyclohexene.
| Compound Name | 1-nonyl-4-prop-2-enylcyclohexene |
|---|---|
| PubChem CID | 175939867 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | 1-nonyl-4-prop-2-enylcyclohexene |
| SMILES | C=CCC1CC=C(CCCCCCCCC)CC1 |
| InChI | InChI=1S/C18H32/c1-3-5-6-7-8-9-10-12-18-15-13-17(11-4-2)14-16-18/h4,15,17H,2-3,5-14,16H2,1H3 |
| InChIKey | WUMVKKVYWUOFQJ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|