C21H30 — CID 21464596
1-(4-but-3-enylcyclohex-3-en-1-yl)-4-pentylbenzene (PubChem CID 21464596) has the molecular formula C21H30 and a molecular weight of 282.47 g/mol. Its IUPAC name is 1-(4-but-3-enylcyclohex-3-en-1-yl)-4-pentylbenzene.
| Compound Name | 1-(4-but-3-enylcyclohex-3-en-1-yl)-4-pentylbenzene |
|---|---|
| PubChem CID | 21464596 |
| Molecular Formula | C21H30 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 1-(4-but-3-enylcyclohex-3-en-1-yl)-4-pentylbenzene |
| SMILES | C=CCCC1=CCC(c2ccc(CCCCC)cc2)CC1 |
| InChI | InChI=1S/C21H30/c1-3-5-7-9-19-12-16-21(17-13-19)20-14-10-18(11-15-20)8-6-4-2/h4,10,12-13,16-17,20H,2-3,5-9,11,14-15H2,1H3 |
| InChIKey | NHLINORNADQKLS-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|