C26H29N — CID 21464549
4-[2-[4-[4-[(E)-pent-3-enyl]cyclohex-3-en-1-yl]phenyl]ethyl]benzonitrile (PubChem CID 21464549) has the molecular formula C26H29N and a molecular weight of 355.53 g/mol. Its IUPAC name is 4-[2-[4-[4-[(E)-pent-3-enyl]cyclohex-3-en-1-yl]phenyl]ethyl]benzonitrile.
| Compound Name | 4-[2-[4-[4-[(E)-pent-3-enyl]cyclohex-3-en-1-yl]phenyl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 21464549 |
| Molecular Formula | C26H29N |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 4-[2-[4-[4-[(E)-pent-3-enyl]cyclohex-3-en-1-yl]phenyl]ethyl]benzonitrile |
| SMILES | C/C=C/CCC1=CCC(c2ccc(CCc3ccc(C#N)cc3)cc2)CC1 |
| InChI | InChI=1S/C26H29N/c1-2-3-4-5-21-12-16-25(17-13-21)26-18-14-23(15-19-26)7-6-22-8-10-24(20-27)11-9-22/h2-3,8-12,14-15,18-19,25H,4-7,13,16-17H2,1H3/b3-2+ |
| InChIKey | XXMBEEXJMCYMME-NSCUHMNNSA-N |
| XLogP | 6.89 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|