About 3-(2-hydroxyethylamino)propane-1,2-diol
3-(2-hydroxyethylamino)propane-1,2-diol (PubChem CID 15034945) has the molecular formula C5H13NO3
and a molecular weight of 135.16 g/mol. Its IUPAC name is 3-(2-hydroxyethylamino)propane-1,2-diol.
Molecular Properties
| Compound Name | 3-(2-hydroxyethylamino)propane-1,2-diol |
| PubChem CID | 15034945 |
| Molecular Formula | C5H13NO3 |
| Molecular Weight | 135.16 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | 3-(2-hydroxyethylamino)propane-1,2-diol |
| SMILES | OCCNCC(O)CO |
| InChI | InChI=1S/C5H13NO3/c7-2-1-6-3-5(9)4-8/h5-9H,1-4H2 |
| InChIKey | WDMIBBXCJKNKPN-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.16 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-hydroxyethylamino)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxyethylamino)propane-1,2-diol?
The IUPAC name of 3-(2-hydroxyethylamino)propane-1,2-diol (CID 15034945) is 3-(2-hydroxyethylamino)propane-1,2-diol.
What is the SMILES notation for 3-(2-hydroxyethylamino)propane-1,2-diol?
The canonical SMILES for 3-(2-hydroxyethylamino)propane-1,2-diol is OCCNCC(O)CO.
What is the InChIKey of 3-(2-hydroxyethylamino)propane-1,2-diol?
The InChIKey is WDMIBBXCJKNKPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO3/c7-2-1-6-3-5(9)4-8/h5-9H,1-4H2.
What are the key properties of 3-(2-hydroxyethylamino)propane-1,2-diol?
3-(2-hydroxyethylamino)propane-1,2-diol has a molecular weight of 135.16 g/mol, XLogP of -2.08, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxyethylamino)propane-1,2-diol is sourced from PubChem (CID 15034945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).