C18H17N5O2 — CID 150354715
4-[2-(aminomethyl)-3-(prop-2-enoylamino)phenyl]-1H-pyrrolo[2,3-c]pyridine-7-carboxamide (PubChem CID 150354715) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is 4-[2-(aminomethyl)-3-(prop-2-enoylamino)phenyl]-1H-pyrrolo[2,3-c]pyridine-7-carboxamide.
| Compound Name | 4-[2-(aminomethyl)-3-(prop-2-enoylamino)phenyl]-1H-pyrrolo[2,3-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 150354715 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 4-[2-(aminomethyl)-3-(prop-2-enoylamino)phenyl]-1H-pyrrolo[2,3-c]pyridine-7-carboxamide |
| SMILES | C=CC(=O)Nc1cccc(-c2cnc(C(N)=O)c3[nH]ccc23)c1CN |
| InChI | InChI=1S/C18H17N5O2/c1-2-15(24)23-14-5-3-4-10(12(14)8-19)13-9-22-17(18(20)25)16-11(13)6-7-21-16/h2-7,9,21H,1,8,19H2,(H2,20,25)(H,23,24) |
| InChIKey | GULXOPZTJLFNRL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|