C10H19NO3S — CID 15035855
tert-butyl 6-hydroxy-1,4-thiazepane-4-carboxylate (PubChem CID 15035855) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is tert-butyl 6-hydroxy-1,4-thiazepane-4-carboxylate.
| Compound Name | tert-butyl 6-hydroxy-1,4-thiazepane-4-carboxylate |
|---|---|
| PubChem CID | 15035855 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | tert-butyl 6-hydroxy-1,4-thiazepane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCSCC(O)C1 |
| InChI | InChI=1S/C10H19NO3S/c1-10(2,3)14-9(13)11-4-5-15-7-8(12)6-11/h8,12H,4-7H2,1-3H3 |
| InChIKey | FICQZWSWLRFLBC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |