About 1-nona-3,8-dien-3-yl-9H-fluorene
1-nona-3,8-dien-3-yl-9H-fluorene (PubChem CID 150361439) has the molecular formula C22H24
and a molecular weight of 288.43 g/mol. Its IUPAC name is 1-nona-3,8-dien-3-yl-9H-fluorene.
Molecular Properties
| Compound Name | 1-nona-3,8-dien-3-yl-9H-fluorene |
| PubChem CID | 150361439 |
| Molecular Formula | C22H24 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 1-nona-3,8-dien-3-yl-9H-fluorene |
| SMILES | C=CCCCC=C(CC)c1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C22H24/c1-3-5-6-7-11-17(4-2)19-14-10-15-21-20-13-9-8-12-18(20)16-22(19)21/h3,8-15H,1,4-7,16H2,2H3 |
| InChIKey | GVUHNDCXEURORF-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-nona-3,8-dien-3-yl-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nona-3,8-dien-3-yl-9H-fluorene?
The IUPAC name of 1-nona-3,8-dien-3-yl-9H-fluorene (CID 150361439) is 1-nona-3,8-dien-3-yl-9H-fluorene.
What is the SMILES notation for 1-nona-3,8-dien-3-yl-9H-fluorene?
The canonical SMILES for 1-nona-3,8-dien-3-yl-9H-fluorene is C=CCCCC=C(CC)c1cccc2c1Cc1ccccc1-2.
What is the InChIKey of 1-nona-3,8-dien-3-yl-9H-fluorene?
The InChIKey is GVUHNDCXEURORF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24/c1-3-5-6-7-11-17(4-2)19-14-10-15-21-20-13-9-8-12-18(20)16-22(19)21/h3,8-15H,1,4-7,16H2,2H3.
What are the key properties of 1-nona-3,8-dien-3-yl-9H-fluorene?
1-nona-3,8-dien-3-yl-9H-fluorene has a molecular weight of 288.43 g/mol, XLogP of 6.41, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nona-3,8-dien-3-yl-9H-fluorene is sourced from PubChem (CID 150361439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).